PRODUCT Properties
| storage temp. | Storage temp. 2-8°C |
| solubility | soluble in Chloroform, Dichloromethane |
| form | powder |
| color | Light pink |
| InChI | 1S/C11H10ClNO/c1-7-5-11(12)13-10-4-3-8(14-2)6-9(7)10/h3-6H,1-2H3 |
| InChIKey | VXGIQWGIRMJJDC-UHFFFAOYSA-N |
| SMILES | ClC1=NC2=C(C(C)=C1)C=C(OC)C=C2 |
Description and Uses
2-Chloro-6-methoxy-4-methylquinoline is an intermediate in the synthesis of Tafenoquine-d3 Succinate which is the labelled analog of Tatenoquine (T004760), a new 8-aminoquinoline with an improved therapeutic index and safety profile as compared to primaquine (P733500).Tafenoquine has the potential to become a widely used drug in the prevention and treatment of malaria infection and could replace some currently used drugs as resistant strains of Plasmodium species increase.
Safety
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H318 |
| Precautionary statements | P264-P270-P280-P301+P312+P330-P305+P351+P338+P310-P501 |
| WGK Germany | WGK 3 |
| HS Code | 2933499090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 |
RELATED PRODUCTS
