LN3641053
95+% , 56392-14-4
Synonym(s):
4-(2-Hydroxy-3-isopropylaminopropoxy)phenylacetic acid;4-[2-Hydroxy-3-[(1-methylethyl)amino]propoxy]benzeneacetic acid;Atenolol acid;Atenolol impurity G (EP)
| Pack Size | Price | Stock | Quantity |
| 25mg | RMB496.80 | In Stock |
|
| 100mg | RMB993.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 174-176°C |
| Boiling point: | 477.1±40.0 °C(Predicted) |
| Density | 1.159±0.06 g/cm3(Predicted) |
| storage temp. | -20°C |
| solubility | DMSO (Slightly), Methanol (Slightly, Heated), Water (Slightly) |
| form | Solid |
| pka | 4.41±0.10(Predicted) |
| color | White to Off-White |
| Stability: | Hygroscopic |
| InChI | 1S/C14H21NO4/c1-10(2)15-8-12(16)9-19-13-5-3-11(4-6-13)7-14(17)18/h3-6,10,12,15-16H,7-9H2,1-2H3,(H,17,18) |
| InChIKey | PUQIRTNPJRFRCZ-UHFFFAOYSA-N |
| SMILES | N(C(C)C)CC(O)COc1ccc(cc1)CC(=O)O |
| CAS DataBase Reference | 56392-14-4 |
Description and Uses
4-(2-Hydroxy-3-isopropylaminopropoxy)phenylacetic acid may be used as an analytical standard for the determination of the analyte in environmental water samples, wastewater samples, and human and animal biological samples by various chromatography techniques.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P280-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| WGK Germany | 3 |
| RTECS | CY1634360 |
| Storage Class | 11 - Combustible Solids |
| Toxicity | LD50 intravenous in dog: > 500mg/kg |






![1,3-Bis[(1-Methylethyl)aMino]-2-propanol Dihydrochloride](https://img.chemicalbook.com/CAS/20150408/GIF/73313-36-7.gif)
