LN3698649
ICI192,605 , ≥98% , 117621-64-4
Synonym(s):
(4Z)-rel-;4(Z)-6-(2-o-chlorophenyl-4-o-hydroxyphenyl-1,3-dioxan-cis-5-yl) hexenoic acid;4-Hexenoic acid;6-[(2R,4R,5S)-2-(2-chlorophenyl)-4-(2-hydroxyphenyl)-1,3-dioxan-5-yl]-
| Pack Size | Price | Stock | Quantity |
| 5mg | RMB1772.00 | In Stock |
|
| 10mg | RMB3192.00 | In Stock |
|
| 25mg | RMB7112.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 124-126 °C |
| Boiling point: | 540.1±50.0 °C(Predicted) |
| Density | 1.262±0.06 g/cm3(Predicted) |
| storage temp. | Desiccate at -20°C |
| solubility | DMSO: ≥20mg/mL |
| form | powder |
| pka | 4.59±0.10(Predicted) |
| color | white to tan |
| InChIKey | WHUIENZXNGAHQI-YGPRPMEGSA-N |
| SMILES | OC(=O)CC\C=C/C[C@H]1CO[C@H](O[C@H]1c2ccccc2O)c3ccccc3Cl |
Description and Uses
ICI 192,605 is a potent thromboxane A2 receptor antagonist.
Safety
| Symbol(GHS) |   GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H302-H410 |
| Precautionary statements | P273-P501 |
| Hazard Codes | Xn,N |
| Risk Statements | 22-50/53 |
| Safety Statements | 60-61 |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 |
