LN3714054
95+% , 140923-27-9
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB1029.60 | In Stock |
|
| 500mg | RMB1936.80 | In Stock |
|
| 1g | RMB2692.80 | In Stock |
|
| 2.5g | RMB5275.20 | In Stock |
|
| 5g | RMB7811.20 | In Stock |
|
| 10g | RMB11585.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| storage temp. | Storage temp. 2-8°C |
| Appearance | Colorless to light yellow Viscous Liquid |
| InChI | InChI=1S/C9H17NO4/c1-5(2)7(8(11)12)10-9(13)14-6(3)4/h5-7H,1-4H3,(H,10,13)(H,11,12)/t7-/m0/s1 |
| InChIKey | BOEQBJGCRDSQAI-ZETCQYMHSA-N |
| SMILES | C(O)(=O)[C@H](C(C)C)NC(OC(C)C)=O |
Description and Uses
(S)-2-((Isopropoxycarbonyl)amino)-3-methylbutanoic Acid can be used in the synthesis of small peptides.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H315-H335 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313P-P264-P280-P302+P352-P321-P332+P313-P362 |
| Hazard Codes | Xi |
| Risk Statements | 36 |
| Safety Statements | 26 |
