LN3882031
≥95% , 25155-18-4
Synonym(s):
N,N-Dimethyl-N-(2-[2-(methyl-4-[1,1,3,3-tetramethylbutyl]phenoxy)ethoxy]ethyl)benzylammonium chloride
CAS NO.：25155-18-4
Empirical Formula: C28H44ClNO2
Molecular Weight: 462.11
MDL number: MFCD00011820
EINECS: 246-675-7
| Pack Size | Price | Stock | Quantity |
| 1g | RMB5520.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 161-163 °C |
| storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| color | White to Off-White |
| Merck | 13,6051 |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C28H44NO2.ClH/c1-23-20-25(14-15-26(23)28(5,6)22-27(2,3)4)31-19-18-30-17-16-29(7,8)21-24-12-10-9-11-13-24;/h9-15,20H,16-19,21-22H2,1-8H3;1H/q+1;/p-1 |
| InChIKey | WYWSKWZUWZLELX-UHFFFAOYSA-M |
| SMILES | C1(OCCOCC[N+](C)(C)CC2=CC=CC=C2)C=CC(C(C)(C)CC(C)(C)C)=C(C)C=1.[Cl-] |
| CAS DataBase Reference | 25155-18-4(CAS DataBase Reference) |
| EPA Substance Registry System | Methylbenzethonium chloride (25155-18-4) |
Description and Uses
Methylbenzethonium Chloride is an anti-leishmanial agent, in the treatment of leishmaniasis, a zoonotic infection affecting people in tropical regions.
Safety
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H314 |
| Precautionary statements | P260-P270-P280-P301+P312-P303+P361+P353-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-37/38-41 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | BO7380000 |
| HS Code | 2923900100 |
