LN3938747
Butralin , 100μg/mlinacetone , 33629-47-9
Synonym(s):
N-sec-Butyl-4-tert-butyl-2,6-dinitroaniline
CAS NO.：33629-47-9
Empirical Formula: C14H21N3O4
Molecular Weight: 295.33
MDL number: MFCD00128046
EINECS: 251-607-4
| Pack Size | Price | Stock | Quantity |
| 1.2ml | RMB80.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 60-61° |
| Boiling point: | bp0.5 134-136° |
| Density | 1.1489 (rough estimate) |
| vapor pressure | 0.001Pa at 25℃ |
| refractive index | 1.5700 (estimate) |
| Flash point: | open cup: 97°F (36°C) |
| storage temp. | 0-6°C |
| solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly, Sonicated) |
| pka | -3.50±0.50(Predicted) |
| form | Solid |
| color | Yellow to orange |
| Water Solubility | 308μg/L at 25℃ |
| Merck | 13,1531 |
| BRN | 2947948 |
| Henry's Law Constant | 2.0×100 mol/(m3Pa) at 25℃, HSDB (2015) |
| InChI | 1S/C14H21N3O4/c1-6-9(2)15-13-11(16(18)19)7-10(14(3,4)5)8-12(13)17(20)21/h7-9,15H,6H2,1-5H3 |
| InChIKey | SPNQRCTZKIBOAX-UHFFFAOYSA-N |
| SMILES | CCC(C)Nc1c(cc(cc1[N+]([O-])=O)C(C)(C)C)[N+]([O-])=O |
| LogP | 4.93 at 23℃ |
| CAS DataBase Reference | 33629-47-9(CAS DataBase Reference) |
| EPA Substance Registry System | Butralin (33629-47-9) |
Description and Uses
Butralin is a pre-emergence herbicide and growth inhibiting substance. It has a low aqueous solubility and is non-volatile. It tends not to be persistent in soils. Its persistent in water systems will depend upon local conditions. Toxicity to biodiversity tends to be moderate to high. It is moderately toxic to mammals if ingested and is an irritant.
Herbicide.
Safety
| Symbol(GHS) |    GHS07,GHS08,GHS09 |
| Signal word | Warning |
| Hazard statements | H302-H319-H341-H410 |
| Precautionary statements | P202-P264-P273-P301+P312-P305+P351+P338-P308+P313 |
| Hazard Codes | T,N,Xn |
| Risk Statements | 24-36/37/38-50/53-36-22-63 |
| Safety Statements | 26-36/37-45-60-61 |
| RIDADR | 1325 |
| WGK Germany | 3 |
| RTECS | BW9500000 |
| TSCA | TSCA listed |
| HazardClass | 4.1 |
| PackingGroup | II |
| HS Code | 29214990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 Repr. 2 |
| Hazardous Substances Data | 33629-47-9(Hazardous Substances Data) |
| Toxicity | LD50 orally in rats: 2500 mg/kg (McLane) |
| REACH Registrations | Active |
