LN3938847
Butralin , 100μg/mlinmethylbenzene , 33629-47-9
Synonym(s):
N-sec-Butyl-4-tert-butyl-2,6-dinitroaniline
CAS NO.:33629-47-9
Empirical Formula: C14H21N3O4
Molecular Weight: 295.33
MDL number: MFCD00128046
EINECS: 251-607-4
| Pack Size | Price | Stock | Quantity |
| 1.2ml | RMB80.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 60-61° |
| Boiling point: | bp0.5 134-136° |
| Density | 1.1489 (rough estimate) |
| vapor pressure | 0.001Pa at 25℃ |
| refractive index | 1.5700 (estimate) |
| Flash point: | open cup: 97°F (36°C) |
| storage temp. | 0-6°C |
| solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly, Sonicated) |
| pka | -3.50±0.50(Predicted) |
| form | Solid |
| color | Yellow to orange |
| Water Solubility | 308μg/L at 25℃ |
| Merck | 13,1531 |
| BRN | 2947948 |
| InChI | 1S/C14H21N3O4/c1-6-9(2)15-13-11(16(18)19)7-10(14(3,4)5)8-12(13)17(20)21/h7-9,15H,6H2,1-5H3 |
| InChIKey | SPNQRCTZKIBOAX-UHFFFAOYSA-N |
| SMILES | CCC(C)Nc1c(cc(cc1[N+]([O-])=O)C(C)(C)C)[N+]([O-])=O |
| LogP | 4.93 at 23℃ |
| CAS DataBase Reference | 33629-47-9(CAS DataBase Reference) |
| EPA Substance Registry System | Butralin (33629-47-9) |
Description and Uses
Herbicide.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS07,GHS08,GHS09 |
| Signal word | Warning |
| Hazard statements | H302-H319-H341-H410 |
| Precautionary statements | P202-P264-P273-P301+P312-P305+P351+P338-P308+P313 |
| Hazard Codes | T,N,Xn |
| Risk Statements | 24-36/37/38-50/53-36-22-63 |
| Safety Statements | 26-36/37-45-60-61 |
| RIDADR | 1325 |
| WGK Germany | 3 |
| RTECS | BW9500000 |
| TSCA | TSCA listed |
| HazardClass | 4.1 |
| PackingGroup | II |
| HS Code | 29214990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 Repr. 2 |
| Hazardous Substances Data | 33629-47-9(Hazardous Substances Data) |
| Toxicity | LD50 orally in rats: 2500 mg/kg (McLane) |





