PRODUCT Properties
| Melting point: | 161.5°C |
| Boiling point: | 465.14°C (rough estimate) |
| Density | 1.1011 (estimate) |
| refractive index | 1.7480 (estimate) |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly, Heated) |
| form | Solid |
| color | Off-White to Pale Yellow |
| Water Solubility | 65ug/L(27 ºC) |
| Major Application | general analytical |
| InChI | InChI=1S/C19H14/c1-13-12-19-16-8-3-2-6-14(16)10-11-18(19)17-9-5-4-7-15(13)17/h2-12H,1H3 |
| InChIKey | ASVDRLYVNFOSCI-UHFFFAOYSA-N |
| SMILES | C1=C2C(C3C(C=C2)=C2C(C=CC=C2)=C(C)C=3)=CC=C1 |
| IARC | 3 (Vol. Sup 7, 92) 2010 |
| EPA Substance Registry System | 6-Methylchrysene (1705-85-7) |
Description and Uses
6-Methylchrysene is one of the methylated chrysenes (MeChry), as an aryl hydrocarbon receptor (AhR) agonist. Methylated chrysenes (MeChry) are important cigarette smoke constituents and 6-MeChry has b een listed as possibly carcinogenic to humans.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H302-H410 |
| Precautionary statements | P264-P270-P273-P301+P312-P391-P501 |
| Hazard Codes | Xn |
| Risk Statements | 22-50 |
| Safety Statements | 61 |
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 |







![6-METHYLBENZO[A]PYRENE](https://img.chemicalbook.com/CAS/GIF/2381-39-7.gif)