LN3991246
HT-2Toxin , 98% , 26934-87-2
CAS NO.：26934-87-2
Empirical Formula: C22H32O8
Molecular Weight: 424.48
MDL number: MFCD32182558
EINECS: 621-720-7
| Pack Size | Price | Stock | Quantity |
| 1mg | RMB2794.40 | In Stock |
|
| 5mg | RMB8600.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 537.1±50.0 °C(Predicted) |
| Density | 1.30±0.1 g/cm3(Predicted) |
| Flash point: | 2 °C |
| storage temp. | −20°C |
| solubility | Dichloromethane: 5 mg/ml; DMSO: soluble; Ethanol: soluble |
| form | White to slight yellow solid. |
| pka | 13.56±0.70(Predicted) |
| color | White to off-white |
| Stability: | Hygroscopic |
| Major Application | cleaning products cosmetics food and beverages personal care |
| InChIKey | PNKLMTPXERFKEN-ZIOSACBISA-N |
| SMILES | CC(C)CC(=O)O[C@H]1C[C@@]2(COC(C)=O)[C@H](O[C@@H]3[C@H](O)[C@@H](O)C2(C)C34CO4)C=C1C |
Description and Uses
HT-2 Toxin is a trichothecene group mycotoxin. HT-2 Toxin is the 4-hydroxy analogue of T-2 Toxin (T002980) which has been shown to induce DNA damage and cell death on prolonged administration.
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H300+H310+H330-H319-H335 |
| Precautionary statements | P260-P264-P270-P280-P301+P310-P302+P352-P330-P304+P340 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | T+,T,Xn,F |
| Risk Statements | 26/27/28-36/37/38-36-20/21/22-11 |
| Safety Statements | 22-26-36/37/39-45-36/37-16 |
| RIDADR | UN 3462 6.1/PG 1 |
| WGK Germany | 3 |
| RTECS | YD0050000 |
| HazardClass | 6.1(a) |
| PackingGroup | I |
| HS Code | 29329990 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Flam. Liq. 2 |
