LN4149251
90% , 450-95-3
CAS NO.：450-95-3
Empirical Formula: C8H7FO
Molecular Weight: 138.14
MDL number: MFCD08461612
EINECS: 207-190-6
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB111.20 | In Stock |
|
| 250mg | RMB186.40 | In Stock |
|
| 1g | RMB374.40 | In Stock |
|
| 5g | RMB1400.00 | In Stock |
|
| 10g | RMB2337.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 26-27 |
| Boiling point: | 187-189 °C(lit.) |
| Density | 1.137 g/mL at 20 °C(lit.) |
| refractive index | n |
| Flash point: | 143 °F |
| storage temp. | Storage temp. 2-8°C |
| form | fused solid |
| color | Off-white |
| InChI | InChI=1S/C8H7FO/c9-6-8(10)7-4-2-1-3-5-7/h1-5H,6H2 |
| InChIKey | YOMBUJAFGMOIGS-UHFFFAOYSA-N |
| SMILES | C(=O)(C1=CC=CC=C1)CF |
| CAS DataBase Reference | 450-95-3(CAS DataBase Reference) |
Description and Uses
2-Fluoroacetophenone is used in method for synthesizing -Fluorinated Ketone by hydrazonation of fatty chain monoketone.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H332-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| Hazard Codes | Xi,F |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 29147000 |
