PRODUCT Properties
| Melting point: | 228-232°; mp 230-232°; mp 138° and 226-232° with resolidification at 175° |
| alpha | D20 -163° (c = 0.5 in pyridine) |
| Boiling point: | 638.28°C (rough estimate) |
| Density | 1.2277 (rough estimate) |
| refractive index | 1.6260 (estimate) |
| storage temp. | -20°C Freezer |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 6.68 in 40% methanol |
| color | White to Off-White |
| InChIKey | CVBMAZKKCSYWQR-TVZLAKDQNA-N |
| SMILES | [C@]12([H])C[C@@]3([H])[C@]([H])(C[C@@H](OC(=O)C4C=C(C(OC)=C(OC)C=4)OC)[C@H](OC)[C@H]3C(=O)OC)CN1CCC1C3=C(C=CC=C3)NC2=1 |&1:0,3,5,8,24,27,r| |
| CAS DataBase Reference | 131-01-1(CAS DataBase Reference) |
| NIST Chemistry Reference | Deserpidine(131-01-1) |
Description and Uses
Deserpidine, is an antihypertensive drug related to Reserpine (R144600). It is naturally found in Rauvolfia spp.




