LN4188949
p-iodo-Clonidine(hydrochloride) , ≥98% , 108294-53-7
Synonym(s):
2-[(2,6-Dichloro-4-iodophenyl)imino]imidazoline hydrochloride
| Pack Size | Price | Stock | Quantity |
| 50mg | RMB1136.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| solubility | H2O: soluble |
| form | solid |
| color | white or off-white |
| Water Solubility | H2O: soluble |
| Major Application | forensics and toxicology pharmaceutical (small molecule) veterinary |
| InChI | 1S/C9H8Cl2IN3.ClH/c10-6-3-5(12)4-7(11)8(6)15-9-13-1-2-14-9;/h3-4H,1-2H2,(H2,13,14,15);1H |
| InChIKey | ULCGXOSKNHMYAX-UHFFFAOYSA-N |
| SMILES | Cl[H].Clc1cc(I)cc(Cl)c1\N=C2/NCCN2 |
Description and Uses
p-Iodoclonidine Hydrochloride is a α2-Adrenergic agonist; and displays a high affinity for the α2-adrenergic receptor.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H312-H332 |
| Precautionary statements | P280 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22 |
| Safety Statements | 36/37/39-45 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral |
