LN4269639
97% , 86215-36-3
| Pack Size | Price | Stock | Quantity |
| 1g | RMB2472.80 | In Stock |
|
| 5g | RMB8448.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| storage temp. | -20°C |
| solubility | DMSO: ≥10mg/mL |
| form | powder |
| color | white to beige |
| InChI | 1S/C11H11Cl2N.ClH/c12-9-2-1-7(3-10(9)13)11-4-8(11)5-14-6-11;/h1-3,8,14H,4-6H2;1H |
| InChIKey | KAGBHVBIOJBGBD-UHFFFAOYSA-N |
| SMILES | Cl.Clc1ccc(cc1Cl)C23CNCC2C3 |
| CAS DataBase Reference | 86215-36-3 |
Description and Uses
DOV-216,303 is an antidepressant compound. DOV-216,303 inhibits the reuptake of norepinephrine (NE), serotonin (5‐HT), and dopamine (DA), with IC50 values of 14 nM, 20 nM and 78 nM for hSERT, hNET and hDAT, respectively. DOV-216,303 increases monoamine release in the prefrontal cortex of olfactory bulbectomized (OBX) rats[1][2][3].
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H319 |
| Precautionary statements | P301+P310+P330-P305+P351+P338 |
| Hazard Codes | T |
| Risk Statements | 25-36 |
| Safety Statements | 26-45 |
| RIDADR | UN 2811 6.1 / PGIII |
| WGK Germany | 3 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 |






