LN4421649
9-Amino-6-chloro-2-methoxyacridine , ≥98% , 3548-09-2
| Pack Size | Price | Stock | Quantity |
| 5mg | RMB732.00 | In Stock |
|
| 10mg | RMB1244.00 | In Stock |
|
| 25mg | RMB2308.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >250°C |
| Boiling point: | 475.1±35.0 °C(Predicted) |
| Density | 1.367±0.06 g/cm3(Predicted) |
| storage temp. | −20°C |
| solubility | Solubility Insoluble in water; soluble in N, N-dimethylformamide, dimethyl sulfoxide |
| form | Solid |
| pka | 8.6(at 25℃) |
| color | Yellow |
| PH Range | Weak blue B uorescence (7.5) to strong blue B uorescence (9.8) |
| Appearance | Solid Powder |
| λmax | 412nm |
| Biological Applications | Antimalarial; bactericidal; detection of cancer cells,nucleic acids; treating malformed proteins causing neurodegenerative disease |
| Major Application | Sensors, detection method for DNA amplification, inhibition of neurode-generative diseases, RNA hydrolysis, fluorescent probes, primers for nucleic acid sequencing, synthesis of nucleic acids, antimalerial agent |
| SMILES | ClC(C=CC1=C2N)=CC1=NC3=C2C=C(OC)C=C3 |
Description and Uses
9-Amino-6-chloro-2-methoxyacridine (ACMA) is a cell-permeable fluorescent probe for labeling DNA with selectivity for poly(dA-dT) sequences. ACMA fluorescence is quenched when a pH gradient is established, a property that has been utilized in animal- and plant-based studies. It also inhibits acetylcholinesterase with a Ki value of 49 nM.
9-Amino-6-chloro-2-methoxyacridine is a nucleic acid stain.
Safety
| Symbol(GHS) | ![]() ![]() GHS08,GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335-H351 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P264-P280-P305+P351+P338-P337+P313P-P201-P202-P281-P308+P313-P405-P501 |
| Hazard Codes | Xn |
| Risk Statements | 36/37/38-40 |
| Safety Statements | 22-26-36 |
| WGK Germany | 3 |
| RTECS | AR7330000 |







![6-CHLORO-9-[3-N-(2-CHLOROETHYL)ETHYLAMINO]PROPYLAMINO-2-METHOXYACRIDINE DIHYDROCHLORIDE](https://img.chemicalbook.com/CAS/GIF/146-59-8.gif)