PRODUCT Properties
| Melting point: | 175-176 °C(lit.) |
| Boiling point: | 435.74°C (rough estimate) |
| Density | 1.0101 (rough estimate) |
| refractive index | 1.4460 (estimate) |
| pka | 4.75±0.10(Predicted) |
| form | powder |
| Water Solubility | 0.8g/L(15 ºC) |
| InChIKey | XWJTYEGVQBFZHI-CVLMAKDASA-N |
| SMILES | OC1[C@@]2(C(CCC2=C3C(C4(C(CC(CC4)O)CC3)C)C1)C(CCC(=O)O)C)C |
Description and Uses
Apocholic Acid which is derived from Cholic Acid (C432600), which is a choleretic produced by and isolated from liver cells.
Safety
| WGK Germany | 3 |
| RTECS | FZ5075000 |
| Storage Class | 11 - Combustible Solids |






