LN4589157
7H-benzo[de]benzo[4,5]imidazo[2,1-a]isoquinolin-7-one , 23749-58-8
CAS NO.:23749-58-8
Empirical Formula: C18H10N2O
Molecular Weight: 270.28
MDL number: MFCD00056826
EINECS: 245-865-7
| Pack Size | Price | Stock | Quantity |
| 10mg | RMB760.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 189 °C |
| Boiling point: | 613.6±38.0 °C(Predicted) |
| Density | 1.40±0.1 g/cm3(Predicted) |
| pka | 2.05±0.20(Predicted) |
| form | powder |
| color | Bright yellow |
| InChI | InChI=1S/C18H10N2O/c21-18-13-8-4-6-11-5-3-7-12(16(11)13)17-19-14-9-1-2-10-15(14)20(17)18/h1-10H |
| InChIKey | NZBSAAMEZYOGBA-UHFFFAOYSA-N |
| SMILES | C12=NC3=CC=CC=C3N1C(=O)C1=CC=CC3=CC=CC2=C13 |
Description and Uses
AHR agonist 3 is an aryl hydrocarbon receptor (AhR) agonist, that can induces cell cycle arrest or apoptosis via activation of tumor-suppressive transcriptional programs. AHR agonist 3 inhibits triple-negative breast cancer (TNBC) stem cell growth via AhR while exhibits minimal cytotoxicity against normal human primary cells and can be used for cancer research[1].
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P312 |
| HS Code | 2933998090 |

![7H-benzo[de]benzo[4,5]imidazo[2,1-a]isoquinolin-7-one](https://img.chemicalbook.com/CAS/GIF/23749-58-8.gif)


![4-[(2,4-Dimethylphenyl)azo]-2,4-dihydro-5-methyl-2-phenyl-3H-pyrazol-3-one](https://img.chemicalbook.com/CAS/GIF/6407-78-9.gif)
