PRODUCT Properties
| Melting point: | 230°C |
| Boiling point: | 744.3±60.0 °C(Predicted) |
| Density | 1.597±0.06 g/cm3 (20 ºC 760 Torr) |
| storage temp. | 2-8°C |
| solubility | Ethanol: slightly soluble; Methanol: slightly soluble |
| form | powder |
| pka | 6.00±0.20(Predicted) |
| BRN | 59993 |
| Major Application | food and beverages |
| InChI | 1S/C21H20O9/c1-7-3-10-14(12(22)4-7)18(26)15-11(17(10)25)5-9(6-13(15)23)30-21-20(28)19(27)16(24)8(2)29-21/h3-6,8,16,19-24,27-28H,1-2H3/t8-,16-,19+,20+,21-/m0/s1 |
| InChIKey | DTTVUKLWJFJOHO-FUCRAMRQSA-N |
| SMILES | C[C@@H]1O[C@@H](OC2=CC(O)=C3C(C(C(C=C(C)C=C4O)=C4C3=O)=O)=C2)[C@H](O)[C@H](O)[C@H]1O |
| LogP | 4.340 (est) |
Description and Uses
Frangulin A, is a novel emodin rhamnoside derivative, that has shown to have anti-proliferative activities on cancer cell lines in vitro.
