LN4882653
2-Bromo-1-chloropropane , 95% , 3017-95-6
CAS NO.:3017-95-6
Empirical Formula: C3H6BrCl
Molecular Weight: 157.44
MDL number: MFCD00009815
EINECS: 221-157-3
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 116-117 °C(lit.) |
| Density | 1.537 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | 2-8°C |
| solubility | Chloroform (Sparingly), Methanol (Slightly) |
| form | Oil |
| color | Colourless |
| BRN | 1731088 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Major Application | environmental |
| InChI | InChI=1S/C3H6BrCl/c1-3(4)2-5/h3H,2H2,1H3 |
| InChIKey | PUJJZGFFAQHYEX-UHFFFAOYSA-N |
| SMILES | C(Cl)C(Br)C |
| CAS DataBase Reference | 3017-95-6(CAS DataBase Reference) |
| EPA Substance Registry System | 2-Bromo-1-chloropropane (3017-95-6) |
Description and Uses
2-?Bromo-?1-?chloropropane is used in calibration of analytical equipment most often in the form of an internal standard.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS06,GHS08,GHS02 |
| Signal word | Danger |
| Hazard statements | H301+H311+H331-H370-H225 |
| Precautionary statements | P260-P280-P301+P310-P311-P210 |
| target organs | Eyes |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn,T,F |
| Risk Statements | 20/21/22-36/37/38-39/23/24/25-23/24/25-11 |
| Safety Statements | 26-36-45-36/37-16-7 |
| RIDADR | 2810 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Flam. Liq. 2 STOT SE 1 |







