LN489889
Benzilic Acid , 99% , 76-93-7
Synonym(s):
Benzilic acid;Diphenylglycolic acid
CAS NO.:76-93-7
Empirical Formula: C14H12O3
Molecular Weight: 228.25
MDL number: MFCD00004447
EINECS: 200-993-2
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 149-151 °C(lit.) |
| Boiling point: | 180 °C |
| Density | 1.28 |
| refractive index | 1.5805 (estimate) |
| Flash point: | 180°C/22mm |
| storage temp. | Store below +30°C. |
| solubility | 1.41g/l (experimental) |
| form | Powder |
| pka | pKa (25°): 3.036 |
| color | White to cream-white |
| Water Solubility | 1.41 g/L (25 ºC) |
| Merck | 14,1080 |
| BRN | 521402 |
| Stability: | Stable. Incompatible with strong oxidizing agents. Combustible. |
| Cosmetics Ingredients Functions | BUFFERING |
| InChI | 1S/C14H12O3/c15-13(16)14(17,11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10,17H,(H,15,16) |
| InChIKey | UKXSKSHDVLQNKG-UHFFFAOYSA-N |
| SMILES | OC(c2ccccc2)(c1ccccc1)C(=O)O |
| LogP | 2.300 |
| CAS DataBase Reference | 76-93-7(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzeneacetic acid, «alpha»-hydroxy-«alpha»-phenyl-(76-93-7) |
| EPA Substance Registry System | Benzilic acid (76-93-7) |
Description and Uses
Benzilic Acid is an impurity of Trospium (T892800), a tropine derivative with anticholinergic activity and a antiispasmodic agent.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P280f-P403+P233-P405 |
| Hazard Codes | Xn |
| Risk Statements | 22-36/37/38-20/21/22 |
| Safety Statements | 36-36/37/39-26 |
| WGK Germany | 3 |
| RTECS | DD2064000 |
| Autoignition Temperature | 530°C |
| TSCA | TSCA listed |
| HS Code | 29181980 |
| Storage Class | 11 - Combustible Solids |
| Hazardous Substances Data | 76-93-7(Hazardous Substances Data) |
| Toxicity | LD50 orl-mus: 2 g/kg AIPTAK 116,154,58 |




