LN4924846
1-HydroxyIbuprofen(IbuprofenImpurityL)(MixtureofDiastereomers) , Analysis standard reagent , 53949-53-4
Synonym(s):
2-[4-(1-Hydroxy-2-methylpropyl)phenyl]propionic acid
| Pack Size | Price | Stock | Quantity |
| 10mg | RMB4074.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 80-85°C |
| Boiling point: | 367.5±22.0 °C(Predicted) |
| Density | 1.119±0.06 g/cm3(Predicted) |
| storage temp. | -20°C Freezer |
| solubility | Acetonitrile (Slightly), Chloroform (Slightly, Heated), Methanol (Slightly) |
| pka | 4.39±0.10(Predicted) |
| color | White to Off-White |
| BRN | 22307543 |
| Major Application | forensics and toxicology pharmaceutical (small molecule) |
| InChI | InChI=1S/C13H18O3/c1-8(2)12(14)11-6-4-10(5-7-11)9(3)13(15)16/h4-9,12,14H,1-3H3,(H,15,16) |
| InChIKey | RMOQYHYFRKTDRI-UHFFFAOYSA-N |
| SMILES | C1(C(C)C(O)=O)=CC=C(C(O)C(C)C)C=C1 |
Description and Uses
1-Hydroxy Ibuprofen, also known as Ibuprofen EP Impurity L, is a degradation product of Ibuprofen. Ibuprofen is a metabolite of the non-steroidal anti-inflammatory drug (NSAID) and non-selective COX inhibitor.






