M0189935
Boc-3-(2-pyridyl)-L-alanine , 98% , 65813-55-0
Synonym(s):
α-Methyl-4-(2-methyl-1-oxopropyl)benzeneacetic acid;(2-(4-Isobutyrylphenyl)propanoic acid);(2RS)-2-(4-Isobutyrylphenyl)propionic acid;(2RS)-2-[4-(2-Methylpropanoyl)phenyl]propanoic acid;1-Oxoibuprofen
| Pack Size | Price | Stock | Quantity |
| 1mg | RMB505.60 | In Stock |
|
| 5mg | RMB1216.00 | In Stock |
|
| 25mg | RMB4224.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 85-87°C |
| Boiling point: | 378.0±17.0 °C(Predicted) |
| Density | 1.106±0.06 g/cm3(Predicted) |
| storage temp. | -20°C Freezer |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 4.08±0.10(Predicted) |
| color | White to Off-White |
| BRN | 2844898 |
| Major Application | pharmaceutical (small molecule) |
| InChI | 1S/C13H16O3/c1-8(2)12(14)11-6-4-10(5-7-11)9(3)13(15)16/h4-9H,1-3H3,(H,15,16) |
| InChIKey | RCINGEKPKJQCMO-UHFFFAOYSA-N |
| SMILES | OC(C(C)C1=CC=C(C(C(C)C)=O)C=C1)=O |
Description and Uses
1-Oxo Ibuprofen, is a degradation product of Ibuprofen arising from oxidative and thermal treatments. 1-Oxo Ibuprofen is the Ibuprofen impurity J.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312-P501 |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| WGK Germany | 3 |
| HS Code | 2917394000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
