LN5011749
99% , 119344-86-4
| Pack Size | Price | Stock | Quantity |
| 1g | RMB238.40 | In Stock |
|
| 5g | RMB612.00 | In Stock |
|
| 25g | RMB1345.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 542.0±50.0 °C(Predicted) |
| Density | 1.083 |
| vapor pressure | 0Pa at 25℃ |
| storage temp. | 2-8°C, protect from light |
| solubility | 2.75 in mg/100g standard fat at 20 ℃ |
| pka | 6.74±0.50(Predicted) |
| Appearance | White to off-white Solid |
| Water Solubility | 1.9mg/L at 20℃ |
| InChI | InChI=1S/C24H32N2O2/c1-5-24(25(3)4,18-20-8-6-19(2)7-9-20)23(27)21-10-12-22(13-11-21)26-14-16-28-17-15-26/h6-13H,5,14-18H2,1-4H3 |
| InChIKey | PUBNJSZGANKUGX-UHFFFAOYSA-N |
| SMILES | C(C1=CC=C(N2CCOCC2)C=C1)(=O)C(N(C)C)(CC1=CC=C(C)C=C1)CC |
| LogP | 4.1 at 25℃ |
| CAS DataBase Reference | 119344-86-4 |
| EPA Substance Registry System | 1-Butanone, 2-(dimethylamino)-2-[(4-methylphenyl)methyl]-1-[4-(4-morpholinyl)phenyl]- (119344-86-4) |
Description and Uses
PI379 (Photoinitiator379) is a highly efficient ultraviolet (UV) initiator, mainly used in UV curing systems such as inks and coatings.
Safety
| Symbol(GHS) |   GHS08,GHS09 |
| Signal word | Warning |
| Hazard statements | H410-H361f |
| Precautionary statements | P273-P391-P501 |
