PRODUCT Properties
| Boiling point: | 110°C |
| Density | 1.2[at 20℃] |
| vapor pressure | 6 x 10-4 Pa (25 °C; free acid) |
| storage temp. | APPROX -18°C |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Liquid |
| Water Solubility | 72.2 g/100 mL at 20 ºC |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C2H5NS2.Na.H/c1-3-2(4)5;;/h1H3,(H2,3,4,5);; |
| InChIKey | WGXKLRCNAQZSNP-UHFFFAOYSA-N |
| SMILES | C(S)(=S)NC.[NaH] |
| LogP | -1.89 |
| CAS DataBase Reference | 137-42-8(CAS DataBase Reference) |
| EPA Substance Registry System | Sodium methyldithiocarbamate (137-42-8) |
Description and Uses
Metam sodium is a crystalline material with an unpleasant odor of sulfur compounds. It reacts in water to generate methyl isothiocyanate, which is the active material. It is applied as a freshly diluted solution in water.
Metam-sodium is a generator of methyl isothiocyanate. It is a soil sterilant applied prior to planting and controls soil fungi, nematodes, weed seeds and soil dwelling insects.
Safety
| Symbol(GHS) |    GHS05,GHS07,GHS09 |
| Signal word | Danger |
| Hazard statements | H302-H314-H317-H410 |
| Precautionary statements | P273-P280-P305+P351+P338-P310-P501 |
| Hazard Codes | C;N,N,C |
| Risk Statements | 22-31-34-50/53-43 |
| Safety Statements | 26-36/37/39-45-60-61 |
| RIDADR | UN 2811 |
| RTECS | FC2100000 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29302000 |
| Hazardous Substances Data | 137-42-8(Hazardous Substances Data) |
| Toxicity | LD50 oral in rabbit: 320mg/kg |
