LN5162639
97% , 5470-37-1
Synonym(s):
1,2,3,4-Tetrahydroharmane-3-carboxylic acid;1-Methyl-1,2,3,4-tetrahydro-β-carboline-3-carboxylic acid;1-Methyl-1,2,3,4-Tetrahydropyrido[3,4-b]indole-3-carboxylic acid;NSC 26225
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB548.80 | In Stock |
|
| 250mg | RMB915.20 | In Stock |
|
| 1g | RMB1830.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 242-243 °C (decomp) |
| Boiling point: | 488.0±45.0 °C(Predicted) |
| Density | 1.301±0.06 g/cm3(Predicted) |
| storage temp. | −20°C |
| solubility | Methanol (Slightly, Heated) |
| form | Solid |
| pka | 2.29±0.40(Predicted) |
| color | White to Off-White |
| Major Application | food and beverages pharmaceutical |
| InChI | 1S/C13H14N2O2/c1-7-12-9(6-11(14-7)13(16)17)8-4-2-3-5-10(8)15-12/h2-5,7,11,14-15H,6H2,1H3,(H,16,17) |
| InChIKey | ZUPHXNBLQCSEIA-UHFFFAOYSA-N |
| SMILES | CC1NC(Cc2c1[nH]c3ccccc23)C(O)=O |
| CAS DataBase Reference | 5470-37-1(CAS DataBase Reference) |
Description and Uses
Reactant involved in synthesis of molecules for biological studies including:• ;Cytotoxicity and insecticidal activities of harmine derivatives1• ;Isoquinolines, β-carbolines, and 3-deazapurines via oxidative decarboxylation2• ;Cytotoxic evaluation of 1,3-di- and 1,3,9-trisubstituted β-carbolines3
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H317-H319 |
| Precautionary statements | P280-P305+P351+P338 |
| Hazard Codes | Xi |
| RIDADR | 1544 |
| WGK Germany | 3 |
| HazardClass | 6.1(b) |
| PackingGroup | III |



![2,3,4,9-Tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylicacid](https://img.chemicalbook.com/CAS/GIF/6052-68-2.gif)


![1,1’-Ethylidenebis[L-tryptophan]](https://img.chemicalbook.com/CAS/GIF/132685-02-0.gif)
