LN5265939
97% , 221121-37-5
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB849.60 | In Stock |
|
| 250mg | RMB1416.00 | In Stock |
|
| 1g | RMB2832.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 295.5±20.0 °C(Predicted) |
| Density | 1.161±0.06 g/cm3(Predicted) |
| storage temp. | Store at 0-8 °C |
| pka | 10.35±0.46(Predicted) |
| Appearance | yellow liquid |
| InChI | InChI=1S/C12H13FO3/c1-2-16-12(15)8-11(14)7-9-3-5-10(13)6-4-9/h3-6H,2,7-8H2,1H3 |
| InChIKey | QCQKQRINQDBSEZ-UHFFFAOYSA-N |
| SMILES | C(C1C=CC(F)=CC=1)C(=O)CC(=O)OCC |
Description and Uses
Ethyl 4-(4-Fluorophenyl)-3-oxobutanoate is used in the synthesis of novel pyridinone derivatives as non-nucleoside reverse transcriptase inhibitors with high potency against NNRTI-resistant HIV-1 strains. Also used in the structural evaluation of 2-substituted 5-hydroxyindole 3-carboxylates as potent inhibitors of human 5-lipoxygenase.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P304+P340-P305+P351+P338-P312-P362-P403+P233-P501 |
