![5-(4'-methyl-[1,1'-biphenyl]-2-yl)-1H-tetrazole](https://img.chemicalbook.com/CAS/GIF/120568-11-8.gif)
LN5281756
5-(4'-methyl-[1,1'-biphenyl]-2-yl)-1H-tetrazole , 0.97 , 120568-11-8
CAS NO.：120568-11-8
Empirical Formula: C14H12N4
Molecular Weight: 236.27
MDL number: MFCD00870018
EINECS: 1592732-453-0
| Pack Size | Price | Stock | Quantity |
| 1g | RMB1150.00 | In Stock |
|
| 5g | RMB4255.00 | In Stock |
|
| 10g | RMB7233.50 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 150 °C |
| Boiling point: | 458.4±48.0 °C(Predicted) |
| Density | 1.216±0.06 g/cm3(Predicted) |
| storage temp. | Refrigerator |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 4.17±0.10(Predicted) |
| color | Off-White to Pale Beige |
| InChI | InChI=1S/C14H12N4/c1-10-6-8-11(9-7-10)12-4-2-3-5-13(12)14-15-17-18-16-14/h2-9H,1H3,(H,15,16,17,18) |
| InChIKey | VWOJMXKARYCRCC-UHFFFAOYSA-N |
| SMILES | N1=C(C2=CC=CC=C2C2=CC=C(C)C=C2)N=NN1 |
Description and Uses
Valsartan (V095750) impurity.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H315-H335-H302 |
| Precautionary statements | P264-P270-P301+P312-P330-P501-P264-P280-P305+P351+P338-P337+P313P-P264-P280-P302+P352-P321-P332+P313-P362 |
![2'-[(1H-Tetrazol-5-yl)biphenyl-4-yl]Methanol](https://img.chemicalbook.com/CAS/GIF/160514-13-6.gif)
![5-(4'-((2-butyl-4-chloro-5-(isopropoxymethyl)-1H-imidazol-1-yl)methyl)-[1,1'-biphenyl]-2-yl)-1H-tetrazole](https://img.chemicalbook.com/CAS/20180703/GIF/1332713-64-0.gif)
