LN5412446
Furalaxyl , Analysis standard reagent , 57646-30-7
CAS NO.：57646-30-7
Empirical Formula: C17H19NO4
Molecular Weight: 301.34
MDL number: MFCD00078674
EINECS: 260-875-1
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB743.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 70℃ |
| Boiling point: | 420.1±45.0 °C(Predicted) |
| Density | 1.179±0.06 g/cm3(Predicted) |
| vapor pressure | 7 x 10-5 Pa (20 °C) |
| storage temp. | 2-8°C |
| Water Solubility | 230 mg l-1 (20 °C) |
| pka | 1.35±0.50(Predicted) |
| form | Solid |
| color | White to off-white |
| BRN | 6427785 |
| Major Application | agriculture environmental |
| InChI | 1S/C17H19NO4/c1-11-7-5-8-12(2)15(11)18(13(3)17(20)21-4)16(19)14-9-6-10-22-14/h5-10,13H,1-4H3 |
| InChIKey | CIEXPHRYOLIQQD-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C)N(C(=O)c1ccco1)c2c(C)cccc2C |
Description and Uses
Furalaxyl is used for the control of soil-borne diseases caused by Phytophthora and Pythium species and other Oomycetes on ornamentals.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H412 |
| Precautionary statements | P273-P301+P312+P330 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 22-52/53 |
| Safety Statements | 36/37/39-61 |
| WGK Germany | 2 |
| RTECS | AY6320000 |
| HS Code | 29321900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 3 |
