LN5594539
95+% , 908266-48-8
CAS NO.：908266-48-8
Empirical Formula: C8H16ClNOS
Molecular Weight: 193.74
MDL number: MFCD12965024
EINECS: 1308068-626-2
| Pack Size | Price | Stock | Quantity |
| 1g | RMB708.00 | In Stock |
|
| 5g | RMB2118.40 | In Stock |
|
| 10g | RMB3174.40 | In Stock |
|
| 25g | RMB6360.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 239-241°C |
| storage temp. | Hygroscopic, Refrigerator, under inert atmosphere |
| solubility | Methanol (Slightly), Water (Slightly) |
| form | Solid |
| color | Off-White |
| Stability: | Hygroscopic |
| InChI | InChI=1/C8H15NS.ClH/c1-9-6-2-3-7(9)5-8(10)4-6;/h6-8,10H,2-5H2,1H3;1H/t6-,7+,8+; |
| InChIKey | IOTZTIZFEAOBRO-OQBUZWGDNA-N |
| SMILES | [C@]12(CC[C@@]([H])(C[C@@H](S)C1)N2C)[H].Cl |&1:0,3,6,r| |
Description and Uses
Tropine-3-thiol Hydrochloride is a derivative of Tropine (T892665), an oxidative product of Tropane, used to synthesize alkaloid derivatives.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P280-P305+P351+P338 |
| HS Code | 2933998090 |
