PRODUCT Properties
| InChI | InChI=1S/C24H27N3/c1-25-21-12-6-18(7-13-21)24(19-8-14-22(15-9-19)26(2)3)20-10-16-23(17-11-20)27(4)5/h6-17H,1-5H3 |
| InChIKey | AMPCGOAFZFKBGH-UHFFFAOYSA-N |
| SMILES | C(=C1C=CC(=NC)C=C1)(C1C=CC(N(C)C)=CC=1)C1C=CC(N(C)C)=CC=1 |c:4,t:0| |
| LogP | 2.381 (est) |
| CAS DataBase Reference | 1325-82-2(CAS DataBase Reference) |
| EPA Substance Registry System | C.I. Basic Violet 1, molybdatetungstatephosphate (1325-82-2) |
Description and Uses
Pigment Violet 3 is mainly used for coloring offset inks, gravure inks, tinplate inks, watercolor and oil paints, interior coatings, and educational supplies.
Safety
| Symbol(GHS) | ![]() ![]() GHS09,GHS05 |
| Signal word | Danger |
| Hazard statements | H318-H400-H410 |
| Precautionary statements | P280-P305+P351+P338-P310-P273-P391-P501-P273-P391-P501 |
| TSCA | TSCA listed |
| Hazardous Substances Data | 1325-82-2(Hazardous Substances Data) |






