LN5765147
Triclopyr 2-Butoxyethyl Ester , 95% , 64700-56-7
CAS NO.：64700-56-7
Empirical Formula: C13H16Cl3NO4
Molecular Weight: 356.63
MDL number: MFCD00145446
EINECS: 265-024-8
| Pack Size | Price | Stock | Quantity |
| 100g | RMB297.60 | In Stock |
|
| 500g | RMB1001.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 421.7±40.0 °C(Predicted) |
| Density | 1.331±0.06 g/cm3(Predicted) |
| storage temp. | 0-6°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | -2.61±0.10(Predicted) |
| color | Clear Colourless to Yellow |
| BRN | 8155305 |
| InChI | InChI=1S/C13H16Cl3NO4/c1-2-3-4-19-5-6-20-11(18)8-21-13-10(15)7-9(14)12(16)17-13/h7H,2-6,8H2,1H3 |
| InChIKey | IVDRCZNHVGQBHZ-UHFFFAOYSA-N |
| SMILES | C(OCCOCCCC)(=O)COC1=NC(Cl)=C(Cl)C=C1Cl |
| EPA Substance Registry System | Triclopyr-butotyl (64700-56-7) |
Description and Uses
Triclopyr Butotyl is a herbicide. It s very effective in reducing the canopy of honey mesquite.
Safety
| Symbol(GHS) |   GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H302-H315-H400 |
| Precautionary statements | P273-P301+P312+P330-P302+P352 |
| Hazard Codes | Xn |
| Risk Statements | 22-38 |
| Safety Statements | 23-24/25 |
| RIDADR | UN 3082 9 / PGIII |
| WGK Germany | 3 |
| RTECS | AJ8970000 |
