LN6114454
97% , 482639-32-7
| Pack Size | Price | Stock | Quantity |
| 1g | RMB3504.00 | In Stock |
|
| 2.5g | RMB6882.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| form | powder |
| color | Yellow |
| InChI | 1S/C12H10ClNO/c1-7-3-8(2)10-5-9(6-15)12(13)14-11(10)4-7/h3-6H,1-2H3 |
| InChIKey | DIMGKYRNZAHUIS-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)c2cc(C=O)c(Cl)nc2c1 |
Description and Uses
2-Chloro-5,7-dimethylquinoline-3-carboxaldehyde is a useful reactant in the synthesis of various organic compounds such as isoxazolo[5,?4-?b]?quinoline derivatives, and 2-?chloroquinolinyl-?4-?quinolinones.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P280-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| WGK Germany | 3 |
| HS Code | 2933499090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
