LN6472853
95% , 92513-40-1
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB738.40 | In Stock |
|
| 250mg | RMB754.40 | In Stock |
|
| 1g | RMB816.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| storage temp. | Store at room temperature |
| form | solid |
| Appearance | White to off-white Solid |
| InChI | 1S/C11H8ClNO2/c1-6-9(11(14)15)5-7-4-8(12)2-3-10(7)13-6/h2-5H,1H3,(H,14,15) |
| InChIKey | BXNOWQXNZZNEJV-UHFFFAOYSA-N |
| SMILES | Clc1cc2c(nc(c(c2)C(=O)O)C)cc1 |
Description and Uses
6-Chloro-2-methyl-quinoline-3-carboxylic acid
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| WGK Germany | WGK 3 |
| HazardClass | IRRITANT |
| HS Code | 2933499090 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Oral |
