PRODUCT Properties
| Melting point: | 241 °C |
| Boiling point: | 519.4±39.0 °C(Predicted) |
| Density | 1.480±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C, stored under nitrogen |
| pka | 6.92±0.20(Predicted) |
| form | Solid |
| Appearance | Light yellow to yellow Solid |
| Major Application | food and beverages |
| InChI | 1S/C14H10O5/c1-18-8-2-3-11-9(6-8)14(17)13-10(16)4-7(15)5-12(13)19-11/h2-6,15-16H,1H3 |
| InChIKey | FVIYCYAHKMJVJK-UHFFFAOYSA-N |
| SMILES | [o]1c2c([c](c3c1ccc(c3)OC)=O)c(cc(c2)O)O |
Description and Uses
food and beverages
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312+P330-P501 |
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
