LN6555051
5,6-O-Isopropylidene-L-gulonicacid-1,4-lactone , 98% , 94697-68-4
| Pack Size | Price | Stock | Quantity |
| 500MG | RMB1344.00 | In Stock |
|
| 1G | RMB1752.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 166-170 °C |
| Boiling point: | 355.712±42.00 °C(Press: 760.00 Torr)(predicted) |
| Density | 1.425±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) |
| storage temp. | -20°C Freezer |
| solubility | Methanol (Slightly), Water (Slightly) |
| pka | 12.023±0.60(predicted) |
| form | Solid |
| color | White to Off-White |
| optical activity | [α]20/D +62±2°, c = 1% in H2O |
| BRN | 5267697 |
| InChI | 1S/C9H14O6/c1-9(2)13-3-4(15-9)7-5(10)6(11)8(12)14-7/h4-7,10-11H,3H2,1-2H3/t4-,5+,6-,7+/m0/s1 |
| InChIKey | JNTPPVKRHGNFKM-BNHYGAARSA-N |
| SMILES | CC1(C)OC[C@H](O1)[C@H]2OC(=O)[C@@H](O)[C@H]2O |
| CAS DataBase Reference | 94697-68-4 |
Description and Uses
5,6-O-Isopropylidene-L-gulonic acid-1,4-lactone is a useful starting material for the synthesis of an array of compounds modified in the 2 and 3 positions.





