LN6886249
98%
| Pack Size | Price | Stock | Quantity |
| 1g | RMB2194.40 | In Stock |
|
| 5g | RMB4708.00 | In Stock |
|
| 10g | RMB6278.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 92-93 °C(Solv: ethanol (64-17-5)) |
| Boiling point: | 308.8±37.0 °C(Predicted) |
| Density | 1.228±0.06 g/cm3(Predicted) |
| pka | 4.41±0.50(Predicted) |
| form | powder |
| color | Light purple |
| InChI | 1S/C11H10ClNO/c1-7-5-10(12)9-6-8(14-2)3-4-11(9)13-7/h3-6H,1-2H3 |
| InChIKey | WABDZSKKLDCIRM-UHFFFAOYSA-N |
| SMILES | ClC1=CC(C)=NC(C=C2)=C1C=C2OC |
Description and Uses
4-Chloro-6-methoxy-2-methylquinoline can be useful in the preparation and stuyd of antitubercular activity, SAR and lipophilicity of ((benzyloxy)benzylamino)alkylquinolines.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-41 |
| Safety Statements | 26-36/37/39-39 |
| WGK Germany | WGK 3 |
| HazardClass | IRRITANT |
| HS Code | 2933499090 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Dam. 1 |
