PRODUCT Properties
| Melting point: | 173-175 °C |
| Boiling point: | 364.2±21.0 °C(Predicted) |
| Density | 1.30 g/cm3 |
| storage temp. | Store at Room Tem. |
| pka | 4.20±0.10(Predicted) |
| InChI | InChI=1S/C14H12O2/c1-10-4-2-3-5-13(10)11-6-8-12(9-7-11)14(15)16/h2-9H,1H3,(H,15,16) |
| InChIKey | NDNIPPKLIDCYGD-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=CC=C2C)=CC=C(C(O)=O)C=C1 |
Description and Uses
4-(2-Methylphenyl)benzoic Acid acts as a reagent in the synthesis of biphenyl imidazole derivatives as potent antifungal agents.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H302-H312-H314-H332 |
| Precautionary statements | P280-P305+P351+P338-P310 |
| Hazard Codes | Xi |
| Hazard Note | Irritant |
| HS Code | 2916399090 |




![2'-(Trifluoromethyl)-[1,1'-biphenyl]-4-carboxylic acid](https://img.chemicalbook.com/CAS/GIF/198205-79-7.gif)

