PRODUCT Properties
| Melting point: | 78°C |
| Boiling point: | 271°C (estimate) |
| Density | 1.0505 (rough estimate) |
| refractive index | 1.4440 (estimate) |
| storage temp. | -20°C Freezer |
| solubility | Acetonitrile (Slightly), Chloroform (Slightly) |
| form | Solid |
| pka | 9.86±0.10(Predicted) |
| color | White to Off-White Waxy |
| InChI | InChI=1S/C9H12O2/c1-6(2)7-3-4-8(10)9(11)5-7/h3-6,10-11H,1-2H3 |
| InChIKey | WYVMDJWLFVQZAL-UHFFFAOYSA-N |
| SMILES | C1(O)=CC=C(C(C)C)C=C1O |
Description and Uses
4-Isopropylcatechol was used in a catalytic aerobic cross-?dehydrogenative coupling (CDC) reaction with phenols to make aryl ethers.
Safety
| Symbol(GHS) |   GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H319-H335-H411-H315 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313P-P264-P280-P302+P352-P321-P332+P313-P362 |
