PRODUCT Properties
| Melting point: | 108° (rapid heating) |
| alpha | D20 +76° (c = 2 in alcohol) |
| Boiling point: | 461.02°C (rough estimate) |
| Density | 1.1478 (rough estimate) |
| refractive index | 1.5700 (estimate) |
| solubility | Acetonitrile (Slightly), Chloroform (Slightly), Ethanol (Slightly), Methanol (Slightly) |
| form | Solid |
| color | White to Pale Beige |
| Water Solubility | 3mg/L(20 ºC) |
| Major Application | pharmaceutical (small molecule) |
| InChI | 1S/C20H22N2O2/c1-3-13-12-22-9-7-14(13)10-19(22)20(23)16-6-8-21-18-5-4-15(24-2)11-17(16)18/h3-6,8,11,13-14,19H,1,7,9-10,12H2,2H3 |
| InChIKey | SRFCUPVBYYAMIL-UHFFFAOYSA-N |
| SMILES | N21C(CC(C(C2)C=C)CC1)C(=O)c3c4c(ncc3)ccc(c4)OC |
Description and Uses
Quininone has been shown to have antimalarial activity in mice. Quininone has been shown to aid the binding of drug-induced antibodies to human platelets.
Safety
| WGK Germany | WGK 3 |
| HS Code | 2939200050 |
| Storage Class | 11 - Combustible Solids |
