LN7433755
97% , 92172-83-3
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB504.00 | In Stock |
|
| 1g | RMB1344.00 | In Stock |
|
| 5g | RMB3908.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 133 °C |
| Boiling point: | 391.4±37.0 °C(Predicted) |
| Density | 1.342±0.06 g/cm3(Predicted) |
| pka | 12.90±0.10(Predicted) |
| form | solid |
| InChI | 1S/C11H10ClNO2/c1-15-9-2-3-10-7(5-9)4-8(6-14)11(12)13-10/h2-5,14H,6H2,1H3 |
| InChIKey | AKKPSGFLKITYGV-UHFFFAOYSA-N |
| SMILES | COC1=CC=C2N=C(C(CO)=CC2=C1)Cl |
Description and Uses
2-Chloro-6-methoxyquinoline-3-methanol is a useful reactant for the synthesis tetrazolylmethyl quinolines.
Safety
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H318 |
| Precautionary statements | P264-P270-P280-P301+P312+P330-P305+P351+P338+P310-P501 |
| Hazard Codes | Xn |
| Risk Statements | 22-41 |
| Safety Statements | 26-39 |
| WGK Germany | WGK 3 |
| HS Code | 2933499090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 |
