PRODUCT Properties
| Flash point: | -10° |
| InChI | InChI=1S/C5H11.BrH.Mg/c1-4-5(2)3;;/h5H,1,4H2,2-3H3;1H;/q;;+1/p-1 |
| InChIKey | JUUNYTVCJDPKMB-UHFFFAOYSA-M |
| SMILES | C(C[Mg]Br)C(C)C |
Description and Uses
Isoamylmagnesium Bromide is a reagent in the synthesis of Perilla Ketone (P287050), an oil from Perilla frutescens which is very toxic as it is a potent pulmonary edemagenic agent for laboratory animals and livestock. This compound is commonly used in oriental foods.
Safety
| Symbol(GHS) |   GHS02,GHS05 |
| Signal word | Danger |
| Hazard statements | H314-H261 |
| Precautionary statements | P231+P232-P280-P370+P378-P402+P404-P501-P260-P264-P280-P301+P330+P331-P303+P361+P353-P363-P304+P340-P310-P321-P305+P351+P338-P405-P501 |
| RIDADR | UN2924 |
| HazardClass | 3, 8 |
| Limited Quantities | 1.0 L (0.3 gallon) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |
