LN7463052
98+% , 89415-43-0
| Pack Size | Price | Stock | Quantity |
| 1g | RMB1108.80 | In Stock |
|
| 5g | RMB3561.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 62-66 |
| Boiling point: | 355.0±44.0 °C(Predicted) |
| Density | 1.23 |
| storage temp. | Store Cold |
| form | solid |
| pka | 8.82±0.10(Predicted) |
| color | Off white |
| InChI | InChI=1S/C6H8BNO2/c8-6-3-1-5(2-4-6)7(9)10/h1-4,9-10H,8H2 |
| InChIKey | MKPDAJWEBQRQCO-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(N)C=C1)(O)O |
| CAS DataBase Reference | 89415-43-0(CAS DataBase Reference) |
Description and Uses
4-Aminophenylboronic Acid is a compound being used in the discovery of multi-target receptor tyrosine kinase inhibitors as novel anti-angiogenesis agents.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P271-P280-P301+P312+P330-P302+P352-P304+P340+P312-P305+P351+P338-P332+P313-P337+P313-P362-P403+P233-P405-P501 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 26-36/37/39-36 |
| Hazard Note | Irritant/Store Cold |
| HS Code | 29310095 |
