LN7523846
Valerenicacid , 98% , 3569-10-6
Synonym(s):
(2E)-3-[(4S,7R,7aR)-2,4,5,6,7,7a-Hexadydro-3,7-dimethyl- 1H-inden-4-yl]-2-methyl-2-propenoic acid
| Pack Size | Price | Stock | Quantity |
| 5mg | RMB3855.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 134-139°C |
| Boiling point: | 374.5±21.0 °C(Predicted) |
| Density | 1.06±0.1 g/cm3(Predicted) |
| storage temp. | −20°C |
| solubility | Chloroform (Slightly), Ethanol (Slightly),Methanol (Slightly) |
| pka | 4.88±0.19(Predicted) |
| form | Solid |
| color | White to Off-White |
| BRN | 3138020 |
| Major Application | cleaning products cosmetics food and beverages personal care |
| InChI | InChI=1S/C15H22O2/c1-9-4-6-12(8-11(3)15(16)17)14-10(2)5-7-13(9)14/h8-9,12-13H,4-7H2,1-3H3,(H,16,17)/b11-8+/t9-,12+,13-/m1/s1 |
| InChIKey | FEBNTWHYQKGEIQ-SUKRRCERSA-N |
| SMILES | C(O)(=O)/C(/C)=C/[C@@H]1CC[C@@H](C)[C@]2([H])C1=C(C)CC2 |
| LogP | 5.188 (est) |
| CAS DataBase Reference | 3569-10-6(CAS DataBase Reference) |
Description and Uses
Valerenic Acid, acts as a subtype-selective GABAA receptor agonist in neonatal rat brainstem preparations. It can be used for the synthesis of Valerena-4,7(11)-diene, a highly active sedative.
Safety
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 3 |
| RTECS | UD3357700 |
| F | 8-10 |
| HS Code | 2916205000 |
| Storage Class | 11 - Combustible Solids |




