LN7656955
95% , 175137-38-9
CAS NO.:175137-38-9
Empirical Formula: C13H10F4N2O2
Molecular Weight: 302.22
MDL number: MFCD00173869
| Pack Size | Price | Stock | Quantity |
| 1g | RMB358.40 | In Stock |
|
| 5g | RMB1282.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 140 °C |
| Density | 1.37±0.1 g/cm3(Predicted) |
| pka | -5.93±0.10(Predicted) |
| form | solid |
| InChI | 1S/C13H10F4N2O2/c1-2-21-12(20)10-7-18-19(11(10)13(15,16)17)9-5-3-8(14)4-6-9/h3-7H,2H2,1H3 |
| InChIKey | WTDWKMYSOQGLIX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cnn(-c2ccc(F)cc2)c1C(F)(F)F |
| CAS DataBase Reference | 175137-38-9(CAS DataBase Reference) |
Description and Uses
ethyl 2-(4-fluorophenyl)-3-(trifluoromethyl)pyrazole-4-carboxylate is an intermediate in the preparation of pyrazolylisoxazoles as IL-17.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280-P271 |
| Hazard Codes | Xi |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 2933199090 |
| Storage Class | 11 - Combustible Solids |







