LN7691251
Amlodipinediethylester , 98% , 140171-65-9
CAS NO.:140171-65-9
Empirical Formula: C21H27ClN2O5
Molecular Weight: 422.9
MDL number: MFCD19704866
| Pack Size | Price | Stock | Quantity |
| 10MG | RMB1011.20 | In Stock |
|
| 50MG | RMB2926.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 106-108°C |
| Boiling point: | 537.8±50.0 °C(Predicted) |
| Density | 1.209±0.06 g/cm3(Predicted) |
| storage temp. | Refrigerator |
| solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) |
| pka | 8.97±0.10(Predicted) |
| form | Solid |
| color | White to Off-White |
| InChI | 1S/C21H27ClN2O5/c1-4-28-20(25)17-13(3)24-16(12-27-11-10-23)19(21(26)29-5-2)18(17)14-8-6-7-9-15(14)22/h6-9,18,24H,4-5,10-12,23H2,1-3H3 |
| InChIKey | BGGLOZPVAWMSEB-UHFFFAOYSA-N |
| SMILES | Clc1c(cccc1)C2C(=C(NC(=C2C(=O)OCC)C)COCCN)C(=O)OCC |
Description and Uses
Amlodipine Besilate (A633500) impurity.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312-P501 |
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |







