S6050751
PharmaceuticalSecondaryStandard;CertifiedReferenceMaterial , 43067-01-2
| Pack Size | Price | Stock | Quantity |
| 50MG | RMB4256.75 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 196-198℃ |
| Boiling point: | 436.7±45.0 °C(Predicted) |
| Density | 1.232±0.06 g/cm3(Predicted) |
| storage temp. | Refrigerator |
| solubility | Chloroform (Slightly), Dichloromethane (Slightly), DMSO (Slightly) |
| form | Solid |
| pka | 2.79±0.70(Predicted) |
| color | Off-White to Pale Yellow |
| Major Application | pharmaceutical (small molecule) |
| InChI | 1S/C17H18ClNO4/c1-9-13(16(20)22-3)15(11-7-5-6-8-12(11)18)14(10(2)19-9)17(21)23-4/h5-8,15,19H,1-4H3 |
| InChIKey | REIGLQUFMMOAFU-UHFFFAOYSA-N |
| SMILES | O=C(OC)C1=C(C)NC(C)=C(C(OC)=O)C1C2=C(Cl)C=CC=C2 |
Description and Uses
Dimethyl 4-(2-Chlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate (Amlodipine EP Impurity G) is an Amlodipine Besilate (A633500) impurity.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P301+P312+P330-P305+P351+P338 |
| target organs | Respiratory system |
| WGK Germany | WGK 3 |
| HS Code | 2933399090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
