LN8349651
AmlodipineEPImpurityF , 98% , 140171-66-0
CAS NO.：140171-66-0
Empirical Formula: C19H23ClN2O5
Molecular Weight: 394.85
MDL number: MFCD19704867
| Pack Size | Price | Stock | Quantity |
| 10MG | RMB1596.00 | In Stock |
|
| 50MG | RMB7075.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 42-45°C |
| Boiling point: | 516.6±50.0 °C(Predicted) |
| Density | 1.247±0.06 g/cm3(Predicted) |
| storage temp. | Hygroscopic, Refrigerator, Under inert atmosphere |
| solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 8.97±0.10(Predicted) |
| color | Pale Yellow to Yellow |
| Stability: | Hygroscopic |
| InChI | 1S/C19H23ClN2O5/c1-11-15(18(23)25-2)16(12-6-4-5-7-13(12)20)17(19(24)26-3)14(22-11)10-27-9-8-21/h4-7,16,22H,8-10,21H2,1-3H3 |
| InChIKey | UDSAEMGNQXMCDF-UHFFFAOYSA-N |
| SMILES | Clc1c(cccc1)C2C(=C(NC(=C2C(=O)OC)C)COCCN)C(=O)OC |
Description and Uses
Amlodipine Besilate (A633500) impurity.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| WGK Germany | WGK 3 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Aquatic Acute 1 Aquatic Chronic 1 Eye Dam. 1 STOT RE 2 |
