LN5778154
95+% , 721958-72-1
CAS NO.:721958-72-1
Empirical Formula: C29H32ClN3O7
Molecular Weight: 570.03
MDL number: MFCD21363412
| Pack Size | Price | Stock | Quantity |
| 1g | RMB4746.40 | In Stock |
|
| 2.5g | RMB9966.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 174-176°C |
| Boiling point: | 756.8±60.0 °C(Predicted) |
| Density | 1.254±0.06 g/cm3(Predicted) |
| storage temp. | -20°C Freezer |
| solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) |
| pka | 13.70±0.46(Predicted) |
| form | Solid |
| color | White to Pale Beige |
| Major Application | pharmaceutical (small molecule) |
| InChIKey | SNNCONCKJDOFKX-UHFFFAOYSA-N |
| SMILES | Clc1c(cccc1)C2C(=C(NC(=C2C(=O)OC)C)COCCNC(=O)c3c(cccc3)C(=O)NC)C(=O)OCC |
Description and Uses
Amlodipine Besilate (A633500) impurity. Amlodipine EP Impurity B
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H412-H302 |
| Precautionary statements | P273-P501-P264-P270-P301+P312-P330-P501 |
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |







