LN7809555
95+% , 146653-56-7
| Pack Size | Price | Stock | Quantity |
| 1g | RMB2458.40 | In Stock |
|
| 5g | RMB8265.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 384.4±42.0 °C(Predicted) |
| Density | 1.30±0.1 g/cm3(Predicted) |
| form | crystalline powder |
| color | Pale lemon/gold |
| InChI | 1S/C16H10F3NO/c17-16(18,19)14-3-1-2-13(9-14)15(21)8-11-4-6-12(10-20)7-5-11/h1-7,9H,8H2 |
| InChIKey | CMHGFDOROXXOOB-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1cccc(c1)C(=O)Cc2ccc(cc2)C#N |
| EPA Substance Registry System | Benzonitrile, 4-[2-oxo-2-[3-(trifluoromethyl)phenyl]ethyl]- (146653-56-7) |
Description and Uses
Metaflumizone(M225825) which is a semicarbazone insecticide that works by blocking sodium channel in target insects resulting in paralyzation associated with blocking nerve activity. Metaflumizone is useful as a heartworm control treatment.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36 |
| Safety Statements | 26 |
| WGK Germany | WGK 3 |
| HS Code | 2926907090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 |
