LN7892257
(S)-3-benzylpiperazine-2,5-dione , 10125-07-2
| Pack Size | Price | Stock | Quantity |
| 5g | RMB3897.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 266-268℃ |
| Boiling point: | 535.1±43.0 °C(Predicted) |
| Density | 1.202 |
| storage temp. | -15°C |
| solubility | DMSO (Slightly), Methanol (Slightly, Heated) |
| form | Solid |
| pka | 13.18±0.40(Predicted) |
| color | White |
| InChI | 1S/C11H12N2O2/c14-10-7-12-11(15)9(13-10)6-8-4-2-1-3-5-8/h1-5,9H,6-7H2,(H,12,15)(H,13,14)/t9-/m0/s1 |
| InChIKey | UZOJHXFWJFSFAI-VIFPVBQESA-N |
| SMILES | O=C1CNC(=O)[C@H](Cc2ccccc2)N1 |
Description and Uses
Cyclo(-Gly-Phe) is used to study the thermodynamics of protein unfolding. It is also able to cause gelation in a wide variety of organic fluids, including edible oils, glyceryl esters, alcohols, and aromatic molecules.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
