LN7993058
4,6,7-Trichloro-2-methylquinoline , 75896-70-7
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB537.60 | In Stock |
|
| 500mg | RMB884.80 | In Stock |
|
| 1g | RMB1422.40 | In Stock |
|
| 2.5g | RMB2609.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| form | solid |
| InChI | 1S/C10H6Cl3N/c1-5-2-7(11)6-3-8(12)9(13)4-10(6)14-5/h2-4H,1H3 |
| InChIKey | GIUJOEVTMZWXCU-UHFFFAOYSA-N |
| SMILES | Cc1cc(Cl)c2cc(Cl)c(Cl)cc2n1 |
Description and Uses
2-Methyl-4,6,7-trichloroquinoline is a useful reagent in the preparation of the analogs of echinorine.
Safety
| Symbol(GHS) |   GHS05,GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H318-H413 |
| Precautionary statements | P280-P301+P310-P305+P351+P338 |
| Hazard Codes | T |
| Risk Statements | 25-41 |
| Safety Statements | 26-39-45 |
| RIDADR | UN 2811 6.1 / PGIII |
| WGK Germany | 3 |
| HS Code | 2933499090 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Aquatic Chronic 4 Eye Dam. 1 |
